C25H17Cl3N2O3S2 — CID 126169029
2-chloro-N-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 126169029) has the molecular formula C25H17Cl3N2O3S2 and a molecular weight of 563.92 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126169029 |
| Molecular Formula | C25H17Cl3N2O3S2 |
| Molecular Weight | 563.92 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C\c3ccccc3OCc3ccc(Cl)cc3Cl)SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C25H17Cl3N2O3S2/c1-14-6-9-18(20(28)10-14)23(31)29-30-24(32)22(35-25(30)34)11-15-4-2-3-5-21(15)33-13-16-7-8-17(26)12-19(16)27/h2-12H,13H2,1H3,(H,29,31)/b22-11+ |
| InChIKey | ZUPFPFUMHWJMRE-SSDVNMTOSA-N |
| XLogP | 7.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.92 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|