C27H21N3O5S2 — CID 126212302
[2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 126212302) has the molecular formula C27H21N3O5S2 and a molecular weight of 531.62 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 126212302 |
| Molecular Formula | C27H21N3O5S2 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(/C=C3\SC(=S)N(NC(=O)c4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H21N3O5S2/c1-17-7-13-21(14-8-17)28-23(31)16-35-26(34)20-11-9-18(10-12-20)15-22-25(33)30(27(36)37-22)29-24(32)19-5-3-2-4-6-19/h2-15H,16H2,1H3,(H,28,31)(H,29,32)/b22-15- |
| InChIKey | MFVNPHFXRVSXED-JCMHNJIXSA-N |
| XLogP | 4.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|