C27H23N3O6S2 — CID 4098707
N-[5-[[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide (PubChem CID 4098707) has the molecular formula C27H23N3O6S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[5-[[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4098707 |
| Molecular Formula | C27H23N3O6S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | N-[5-[[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)C(=Cc3ccc(OCC(=O)Nc4ccccc4)c(OC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C27H23N3O6S2/c1-34-20-11-9-18(10-12-20)25(32)29-30-26(33)23(38-27(30)37)15-17-8-13-21(22(14-17)35-2)36-16-24(31)28-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | BZASUIHTRFMCRO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|