C20H15FN2O6S2 — CID 27420924
2-[4-[(E)-[3-[(4-fluorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 27420924) has the molecular formula C20H15FN2O6S2 and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(4-fluorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[3-[(4-fluorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 27420924 |
| Molecular Formula | C20H15FN2O6S2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[4-[(E)-[3-[(4-fluorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(F)cc3)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H15FN2O6S2/c1-28-15-8-11(2-7-14(15)29-10-17(24)25)9-16-19(27)23(20(30)31-16)22-18(26)12-3-5-13(21)6-4-12/h2-9H,10H2,1H3,(H,22,26)(H,24,25)/b16-9+ |
| InChIKey | YEJLKRNZNBUKBW-CXUHLZMHSA-N |
| XLogP | 2.84 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|