C21H15Cl3N2O7S2 — CID 6275414
2-[2-methoxy-4-[(Z)-[4-oxo-2-sulfanylidene-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 6275414) has the molecular formula C21H15Cl3N2O7S2 and a molecular weight of 577.85 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[4-oxo-2-sulfanylidene-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(Z)-[4-oxo-2-sulfanylidene-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6275414 |
| Molecular Formula | C21H15Cl3N2O7S2 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 575.94 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[4-oxo-2-sulfanylidene-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(NC(=O)COc3cc(Cl)c(Cl)cc3Cl)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H15Cl3N2O7S2/c1-31-16-4-10(2-3-14(16)33-9-19(28)29)5-17-20(30)26(21(34)35-17)25-18(27)8-32-15-7-12(23)11(22)6-13(15)24/h2-7H,8-9H2,1H3,(H,25,27)(H,28,29)/b17-5- |
| InChIKey | SQNWOPGQBHHOBZ-ZWSORDCHSA-N |
| XLogP | 4.43 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|