C22H20Cl3N3O3S2 — CID 3390734
N-[5-[[4-(diethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 3390734) has the molecular formula C22H20Cl3N3O3S2 and a molecular weight of 544.91 g/mol. Its IUPAC name is N-[5-[[4-(diethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[5-[[4-(diethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3390734 |
| Molecular Formula | C22H20Cl3N3O3S2 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 543.00 |
| IUPAC Name | N-[5-[[4-(diethylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CCN(CC)c1ccc(C=C2SC(=S)N(NC(=O)COc3cc(Cl)c(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H20Cl3N3O3S2/c1-3-27(4-2)14-7-5-13(6-8-14)9-19-21(30)28(22(32)33-19)26-20(29)12-31-18-11-16(24)15(23)10-17(18)25/h5-11H,3-4,12H2,1-2H3,(H,26,29) |
| InChIKey | YPUYYQZANNMIHI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|