C18H10BrCl3N2O3S2 — CID 3388726
N-[5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 3388726) has the molecular formula C18H10BrCl3N2O3S2 and a molecular weight of 552.69 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3388726 |
| Molecular Formula | C18H10BrCl3N2O3S2 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 549.84 |
| IUPAC Name | N-[5-[(4-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NN1C(=O)C(=Cc2ccc(Br)cc2)SC1=S |
| InChI | InChI=1S/C18H10BrCl3N2O3S2/c19-10-3-1-9(2-4-10)5-15-17(26)24(18(28)29-15)23-16(25)8-27-14-7-12(21)11(20)6-13(14)22/h1-7H,8H2,(H,23,25) |
| InChIKey | LYPHISGFGDTFSS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|