C21H15BrCl3N3O3S — CID 18804133
N-[(E)-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 18804133) has the molecular formula C21H15BrCl3N3O3S and a molecular weight of 575.70 g/mol. Its IUPAC name is N-[(E)-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 18804133 |
| Molecular Formula | C21H15BrCl3N3O3S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 572.91 |
| IUPAC Name | N-[(E)-[(5Z)-5-[(4-bromophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(Br)cc2)S/C1=N/NC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H15BrCl3N3O3S/c1-2-7-28-20(30)18(8-12-3-5-13(22)6-4-12)32-21(28)27-26-19(29)11-31-17-10-15(24)14(23)9-16(17)25/h2-6,8-10H,1,7,11H2,(H,26,29)/b18-8-,27-21+ |
| InChIKey | XGIDPZDWGDSXHH-XKCJGCHYSA-N |
| XLogP | 5.98 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|