C23H20Cl3N3O5S — CID 3399472
N-[[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 3399472) has the molecular formula C23H20Cl3N3O5S and a molecular weight of 556.86 g/mol. Its IUPAC name is N-[[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3399472 |
| Molecular Formula | C23H20Cl3N3O5S |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | N-[[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OC)c(OC)c2)SC1=NNC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl3N3O5S/c1-4-7-29-22(31)20(9-13-5-6-17(32-2)19(8-13)33-3)35-23(29)28-27-21(30)12-34-18-11-15(25)14(24)10-16(18)26/h4-6,8-11H,1,7,12H2,2-3H3,(H,27,30) |
| InChIKey | YMEQWZSXAKLTDG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|