C24H17FN2O6S3 — CID 73462872
[4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 73462872) has the molecular formula C24H17FN2O6S3 and a molecular weight of 544.61 g/mol. Its IUPAC name is [4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 73462872 |
| Molecular Formula | C24H17FN2O6S3 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | [4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1cc(C=C2SC(=S)N(NC(=O)c3ccccc3)C2=O)ccc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H17FN2O6S3/c1-32-20-13-15(7-12-19(20)33-36(30,31)18-10-8-17(25)9-11-18)14-21-23(29)27(24(34)35-21)26-22(28)16-5-3-2-4-6-16/h2-14H,1H3,(H,26,28) |
| InChIKey | LFYQQBYAOVHLAK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|