C28H22N2O6S — CID 126228973
[2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 126228973) has the molecular formula C28H22N2O6S and a molecular weight of 514.56 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 126228973 |
| Molecular Formula | C28H22N2O6S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(/C=C3\SC(=O)N(CC(=O)c4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H22N2O6S/c1-18-7-13-22(14-8-18)29-25(32)17-36-27(34)21-11-9-19(10-12-21)15-24-26(33)30(28(35)37-24)16-23(31)20-5-3-2-4-6-20/h2-15H,16-17H2,1H3,(H,29,32)/b24-15- |
| InChIKey | CQJVJSDZDLEUFD-IWIPYMOSSA-N |
| XLogP | 4.71 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|