C26H19BrN2O5S — CID 126278708
[4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 126278708) has the molecular formula C26H19BrN2O5S and a molecular weight of 551.42 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 126278708 |
| Molecular Formula | C26H19BrN2O5S |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | [4-[(Z)-[3-[2-(4-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OC(=O)c4cccc(Br)c4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H19BrN2O5S/c1-16-5-9-20(10-6-16)28-23(30)15-29-24(31)22(35-26(29)33)13-17-7-11-21(12-8-17)34-25(32)18-3-2-4-19(27)14-18/h2-14H,15H2,1H3,(H,28,30)/b22-13- |
| InChIKey | ZTZZGRWKWDEOTF-XKZIYDEJSA-N |
| XLogP | 5.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|