C26H18BrClN2O6S — CID 126212294
[4-[(E)-[3-[2-(4-bromo-3-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126212294) has the molecular formula C26H18BrClN2O6S and a molecular weight of 601.86 g/mol. Its IUPAC name is [4-[(E)-[3-[2-(4-bromo-3-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-[3-[2-(4-bromo-3-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126212294 |
| Molecular Formula | C26H18BrClN2O6S |
| Molecular Weight | 601.86 g/mol |
| Exact Mass | 599.98 |
| IUPAC Name | [4-[(E)-[3-[2-(4-bromo-3-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccc(Br)c(Cl)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H18BrClN2O6S/c1-35-18-9-4-16(5-10-18)25(33)36-19-7-2-15(3-8-19)12-22-24(32)30(26(34)37-22)14-23(31)29-17-6-11-20(27)21(28)13-17/h2-13H,14H2,1H3,(H,29,31)/b22-12+ |
| InChIKey | HIVMVULCPJRNJN-WSDLNYQXSA-N |
| XLogP | 6.01 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|