C26H19N3O6S2 — CID 126205044
[2-(4-methylanilino)-2-oxoethyl] 4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 126205044) has the molecular formula C26H19N3O6S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 126205044 |
| Molecular Formula | C26H19N3O6S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(/C=C3/SC(=S)N(c4cccc([N+](=O)[O-])c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H19N3O6S2/c1-16-5-11-19(12-6-16)27-23(30)15-35-25(32)18-9-7-17(8-10-18)13-22-24(31)28(26(36)37-22)20-3-2-4-21(14-20)29(33)34/h2-14H,15H2,1H3,(H,27,30)/b22-13+ |
| InChIKey | LHMLUSHWHZJTIW-LPYMAVHISA-N |
| XLogP | 5.10 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|