C25H19N3O6S2 — CID 126347312
N-(2-methoxyphenyl)-2-[4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126347312) has the molecular formula C25H19N3O6S2 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126347312 |
| Molecular Formula | C25H19N3O6S2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[4-[(E)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2/SC(=S)N(c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C25H19N3O6S2/c1-33-21-8-3-2-7-20(21)26-23(29)15-34-19-11-9-16(10-12-19)13-22-24(30)27(25(35)36-22)17-5-4-6-18(14-17)28(31)32/h2-14H,15H2,1H3,(H,26,29)/b22-13+ |
| InChIKey | ALDZTAFMJOXCCP-LPYMAVHISA-N |
| XLogP | 5.03 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|