C28H25N3O7S — CID 126282262
2-[(5Z)-5-[[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126282262) has the molecular formula C28H25N3O7S and a molecular weight of 547.59 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126282262 |
| Molecular Formula | C28H25N3O7S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-[(5Z)-5-[[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C28H25N3O7S/c1-36-22-9-5-3-7-20(22)29-25(32)16-31-27(34)24(39-28(31)35)15-18-11-13-19(14-12-18)38-17-26(33)30-21-8-4-6-10-23(21)37-2/h3-15H,16-17H2,1-2H3,(H,29,32)(H,30,33)/b24-15- |
| InChIKey | YMXOZJFGNUNUJU-IWIPYMOSSA-N |
| XLogP | 4.40 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|