C26H30N2O5S2 — CID 126267659
N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126267659) has the molecular formula C26H30N2O5S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126267659 |
| Molecular Formula | C26H30N2O5S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(CCCOC)C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H30N2O5S2/c1-5-32-22-14-19(15-23-25(30)28(26(34)35-23)11-6-12-31-4)8-10-21(22)33-16-24(29)27-20-9-7-17(2)18(3)13-20/h7-10,13-15H,5-6,11-12,16H2,1-4H3,(H,27,29)/b23-15- |
| InChIKey | DGDNFIPWWQMHOE-HAHDFKILSA-N |
| XLogP | 4.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|