C20H23NO5 — CID 118907133
2-ethoxy-3-[4-[2-imino-2-(3-methoxyphenyl)ethoxy]phenyl]propanoic acid (PubChem CID 118907133) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-imino-2-(3-methoxyphenyl)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-imino-2-(3-methoxyphenyl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118907133 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-ethoxy-3-[4-[2-imino-2-(3-methoxyphenyl)ethoxy]phenyl]propanoic acid |
| SMILES | [H]/N=C(\COc1ccc(CC(OCC)C(=O)O)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H23NO5/c1-3-25-19(20(22)23)11-14-7-9-16(10-8-14)26-13-18(21)15-5-4-6-17(12-15)24-2/h4-10,12,19,21H,3,11,13H2,1-2H3,(H,22,23)/b21-18+ |
| InChIKey | JCIAZWPJHMARNX-DYTRJAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|