C18H15N3O7 — CID 75112798
3-[4-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2-(oxaloamino)propanoic acid (PubChem CID 75112798) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is 3-[4-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | 3-[4-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 75112798 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3-[4-(2,1,3-benzoxadiazol-5-ylmethoxy)phenyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)NC(Cc1ccc(OCc2ccc3nonc3c2)cc1)C(=O)O |
| InChI | InChI=1S/C18H15N3O7/c22-16(18(25)26)19-15(17(23)24)7-10-1-4-12(5-2-10)27-9-11-3-6-13-14(8-11)21-28-20-13/h1-6,8,15H,7,9H2,(H,19,22)(H,23,24)(H,25,26) |
| InChIKey | LXCDRRVJIAPHOO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|