C18H14ClNO7 — CID 45376260
(2R)-3-[4-(2-chlorobenzoyl)oxyphenyl]-2-(oxaloamino)propanoic acid (PubChem CID 45376260) has the molecular formula C18H14ClNO7 and a molecular weight of 391.76 g/mol. Its IUPAC name is (2R)-3-[4-(2-chlorobenzoyl)oxyphenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[4-(2-chlorobenzoyl)oxyphenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 45376260 |
| Molecular Formula | C18H14ClNO7 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (2R)-3-[4-(2-chlorobenzoyl)oxyphenyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)N[C@H](Cc1ccc(OC(=O)c2ccccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C18H14ClNO7/c19-13-4-2-1-3-12(13)18(26)27-11-7-5-10(6-8-11)9-14(16(22)23)20-15(21)17(24)25/h1-8,14H,9H2,(H,20,21)(H,22,23)(H,24,25)/t14-/m1/s1 |
| InChIKey | OHMXUONFHXOVGO-CQSZACIVSA-N |
| XLogP | 1.76 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|