C26H29ClN2O4 — CID 143139793
2-[(2-chlorobenzoyl)amino]-3-[4-[cyclobutylidene(piperidin-1-yl)methoxy]phenyl]propanoic acid (PubChem CID 143139793) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-3-[4-[cyclobutylidene(piperidin-1-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-3-[4-[cyclobutylidene(piperidin-1-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143139793 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-3-[4-[cyclobutylidene(piperidin-1-yl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OC(=C2CCC2)N2CCCCC2)cc1)C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C26H29ClN2O4/c27-22-10-3-2-9-21(22)24(30)28-23(26(31)32)17-18-11-13-20(14-12-18)33-25(19-7-6-8-19)29-15-4-1-5-16-29/h2-3,9-14,23H,1,4-8,15-17H2,(H,28,30)(H,31,32) |
| InChIKey | OSUZGWHQEUWTPF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|