C23H24ClN3O5 — CID 89149371
(2S)-3-[4-[butyl(cyanomethyl)carbamoyl]oxyphenyl]-2-[(2-chlorobenzoyl)amino]propanoic acid (PubChem CID 89149371) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is (2S)-3-[4-[butyl(cyanomethyl)carbamoyl]oxyphenyl]-2-[(2-chlorobenzoyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-[butyl(cyanomethyl)carbamoyl]oxyphenyl]-2-[(2-chlorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 89149371 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (2S)-3-[4-[butyl(cyanomethyl)carbamoyl]oxyphenyl]-2-[(2-chlorobenzoyl)amino]propanoic acid |
| SMILES | CCCCN(CC#N)C(=O)Oc1ccc(C[C@H](NC(=O)c2ccccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C23H24ClN3O5/c1-2-3-13-27(14-12-25)23(31)32-17-10-8-16(9-11-17)15-20(22(29)30)26-21(28)18-6-4-5-7-19(18)24/h4-11,20H,2-3,13-15H2,1H3,(H,26,28)(H,29,30)/t20-/m0/s1 |
| InChIKey | MFKMIKZDNYPOMF-FQEVSTJZSA-N |
| XLogP | 3.89 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|