C33H39ClN2O6 — CID 143139786
butane;2-[(2-chlorobenzoyl)amino]-3-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethenoxy]phenyl]propanoic acid (PubChem CID 143139786) has the molecular formula C33H39ClN2O6 and a molecular weight of 595.14 g/mol. Its IUPAC name is butane;2-[(2-chlorobenzoyl)amino]-3-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethenoxy]phenyl]propanoic acid.
| Compound Name | butane;2-[(2-chlorobenzoyl)amino]-3-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143139786 |
| Molecular Formula | C33H39ClN2O6 |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | butane;2-[(2-chlorobenzoyl)amino]-3-[4-[1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethenoxy]phenyl]propanoic acid |
| SMILES | C=C(Oc1ccc(CC(NC(=O)c2ccccc2Cl)C(=O)O)cc1)N1CCc2cc(OC)c(OC)cc2C1.CCCC |
| InChI | InChI=1S/C29H29ClN2O6.C4H10/c1-18(32-13-12-20-15-26(36-2)27(37-3)16-21(20)17-32)38-22-10-8-19(9-11-22)14-25(29(34)35)31-28(33)23-6-4-5-7-24(23)30;1-3-4-2/h4-11,15-16,25H,1,12-14,17H2,2-3H3,(H,31,33)(H,34,35);3-4H2,1-2H3 |
| InChIKey | XUAPRWJRRZTHQJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|