C23H25ClN2O5S — CID 21018848
ethyl 2-[(2-chlorobenzoyl)amino]-3-[4-(morpholine-4-carbothioyloxy)phenyl]propanoate (PubChem CID 21018848) has the molecular formula C23H25ClN2O5S and a molecular weight of 476.98 g/mol. Its IUPAC name is ethyl 2-[(2-chlorobenzoyl)amino]-3-[4-(morpholine-4-carbothioyloxy)phenyl]propanoate.
| Compound Name | ethyl 2-[(2-chlorobenzoyl)amino]-3-[4-(morpholine-4-carbothioyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 21018848 |
| Molecular Formula | C23H25ClN2O5S |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | ethyl 2-[(2-chlorobenzoyl)amino]-3-[4-(morpholine-4-carbothioyloxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC(=S)N2CCOCC2)cc1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H25ClN2O5S/c1-2-30-22(28)20(25-21(27)18-5-3-4-6-19(18)24)15-16-7-9-17(10-8-16)31-23(32)26-11-13-29-14-12-26/h3-10,20H,2,11-15H2,1H3,(H,25,27) |
| InChIKey | MNBCINOTOXMQIW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|