C29H29FN2O5 — CID 158287580
[4-[2-[(2-fluorobenzoyl)amino]-4-(2-morpholin-4-ylphenyl)-3-oxobutyl]phenyl] acetate (PubChem CID 158287580) has the molecular formula C29H29FN2O5 and a molecular weight of 504.56 g/mol. Its IUPAC name is [4-[2-[(2-fluorobenzoyl)amino]-4-(2-morpholin-4-ylphenyl)-3-oxobutyl]phenyl] acetate.
| Compound Name | [4-[2-[(2-fluorobenzoyl)amino]-4-(2-morpholin-4-ylphenyl)-3-oxobutyl]phenyl] acetate |
|---|---|
| PubChem CID | 158287580 |
| Molecular Formula | C29H29FN2O5 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [4-[2-[(2-fluorobenzoyl)amino]-4-(2-morpholin-4-ylphenyl)-3-oxobutyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC(NC(=O)c2ccccc2F)C(=O)Cc2ccccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H29FN2O5/c1-20(33)37-23-12-10-21(11-13-23)18-26(31-29(35)24-7-3-4-8-25(24)30)28(34)19-22-6-2-5-9-27(22)32-14-16-36-17-15-32/h2-13,26H,14-19H2,1H3,(H,31,35) |
| InChIKey | PIMCPRQIJPUEPB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|