C27H28F2N4O2 — CID 157371332
N-[4-[2-(4-aminopiperazin-1-yl)-5-fluorophenyl]-3-oxo-1-phenylbutan-2-yl]-2-fluorobenzamide (PubChem CID 157371332) has the molecular formula C27H28F2N4O2 and a molecular weight of 478.54 g/mol. Its IUPAC name is N-[4-[2-(4-aminopiperazin-1-yl)-5-fluorophenyl]-3-oxo-1-phenylbutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[4-[2-(4-aminopiperazin-1-yl)-5-fluorophenyl]-3-oxo-1-phenylbutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 157371332 |
| Molecular Formula | C27H28F2N4O2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[4-[2-(4-aminopiperazin-1-yl)-5-fluorophenyl]-3-oxo-1-phenylbutan-2-yl]-2-fluorobenzamide |
| SMILES | NN1CCN(c2ccc(F)cc2CC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H28F2N4O2/c28-21-10-11-25(32-12-14-33(30)15-13-32)20(17-21)18-26(34)24(16-19-6-2-1-3-7-19)31-27(35)22-8-4-5-9-23(22)29/h1-11,17,24H,12-16,18,30H2,(H,31,35) |
| InChIKey | NCRDETACVRTLKV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|