C20H22F2N2O2 — CID 122037935
(2R)-2-[[1-(2,4-difluorophenyl)piperidin-4-yl]amino]-3-phenylpropanoic acid (PubChem CID 122037935) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is (2R)-2-[[1-(2,4-difluorophenyl)piperidin-4-yl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[1-(2,4-difluorophenyl)piperidin-4-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122037935 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2R)-2-[[1-(2,4-difluorophenyl)piperidin-4-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NC1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H22F2N2O2/c21-15-6-7-19(17(22)13-15)24-10-8-16(9-11-24)23-18(20(25)26)12-14-4-2-1-3-5-14/h1-7,13,16,18,23H,8-12H2,(H,25,26)/t18-/m1/s1 |
| InChIKey | MZIWLQBNVPGQQW-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |