C18H17F2N3O2 — CID 95614867
N-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-phenyloxamide (PubChem CID 95614867) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-phenyloxamide.
| Compound Name | N-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 95614867 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-N'-phenyloxamide |
| SMILES | O=C(Nc1ccccc1)C(=O)N[C@@H]1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H17F2N3O2/c19-12-6-7-16(15(20)10-12)23-9-8-14(11-23)22-18(25)17(24)21-13-4-2-1-3-5-13/h1-7,10,14H,8-9,11H2,(H,21,24)(H,22,25)/t14-/m1/s1 |
| InChIKey | OFHMINNFZNEGJY-CQSZACIVSA-N |
| XLogP | 2.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|