C21H25F2N3O3S — CID 86895952
1-(3-benzylsulfonylpropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]urea (PubChem CID 86895952) has the molecular formula C21H25F2N3O3S and a molecular weight of 437.51 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 86895952 |
| Molecular Formula | C21H25F2N3O3S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]urea |
| SMILES | O=C(NCCCS(=O)(=O)Cc1ccccc1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H25F2N3O3S/c22-17-7-8-20(19(23)13-17)26-11-9-18(14-26)25-21(27)24-10-4-12-30(28,29)15-16-5-2-1-3-6-16/h1-3,5-8,13,18H,4,9-12,14-15H2,(H2,24,25,27) |
| InChIKey | ABSSXAHBASNITK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|