C23H27F2N3O2 — CID 86896057
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[(2-phenyloxan-3-yl)methyl]urea (PubChem CID 86896057) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[(2-phenyloxan-3-yl)methyl]urea.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[(2-phenyloxan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 86896057 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-[(2-phenyloxan-3-yl)methyl]urea |
| SMILES | O=C(NCC1CCCOC1c1ccccc1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H27F2N3O2/c24-18-8-9-21(20(25)13-18)28-11-10-19(15-28)27-23(29)26-14-17-7-4-12-30-22(17)16-5-2-1-3-6-16/h1-3,5-6,8-9,13,17,19,22H,4,7,10-12,14-15H2,(H2,26,27,29) |
| InChIKey | CKWVPGGDSGONJF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |