C16H15F2N3OS — CID 56782524
N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 56782524) has the molecular formula C16H15F2N3OS and a molecular weight of 335.38 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56782524 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ccc(F)cc2F)C1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C16H15F2N3OS/c17-10-3-4-14(13(18)8-10)21-7-5-11(9-21)20-15(22)12-2-1-6-19-16(12)23/h1-4,6,8,11H,5,7,9H2,(H,19,23)(H,20,22) |
| InChIKey | HOHMPEVYHZRVLK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|