C16H13F2N3O2S — CID 91644390
N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 91644390) has the molecular formula C16H13F2N3O2S and a molecular weight of 349.36 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91644390 |
| Molecular Formula | C16H13F2N3O2S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2c(F)cccc2F)C1=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C16H13F2N3O2S/c17-10-4-1-5-11(18)13(10)21-8-6-12(16(21)23)20-14(22)9-3-2-7-19-15(9)24/h1-5,7,12H,6,8H2,(H,19,24)(H,20,22) |
| InChIKey | CDILMSGEGXYXFZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|