C11H14FN3O2 — CID 118296358
[1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 118296358) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is [1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118296358 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | Nc1cc(F)ccc1N1CCC(NC(=O)O)C1 |
| InChI | InChI=1S/C11H14FN3O2/c12-7-1-2-10(9(13)5-7)15-4-3-8(6-15)14-11(16)17/h1-2,5,8,14H,3-4,6,13H2,(H,16,17) |
| InChIKey | ZBQZVNASEJKAFJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|