C12H15ClFN3O — CID 114089074
N-[1-(2-amino-5-chloro-4-fluorophenyl)pyrrolidin-3-yl]acetamide (PubChem CID 114089074) has the molecular formula C12H15ClFN3O and a molecular weight of 271.72 g/mol. Its IUPAC name is N-[1-(2-amino-5-chloro-4-fluorophenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(2-amino-5-chloro-4-fluorophenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 114089074 |
| Molecular Formula | C12H15ClFN3O |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[1-(2-amino-5-chloro-4-fluorophenyl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2cc(Cl)c(F)cc2N)C1 |
| InChI | InChI=1S/C12H15ClFN3O/c1-7(18)16-8-2-3-17(6-8)12-4-9(13)10(14)5-11(12)15/h4-5,8H,2-3,6,15H2,1H3,(H,16,18) |
| InChIKey | UVQWVTAEMBHBGR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|