C12H16ClFN2O — CID 114088890
4-chloro-2-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline (PubChem CID 114088890) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is 4-chloro-2-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline.
| Compound Name | 4-chloro-2-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 114088890 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-chloro-2-(2,6-dimethylmorpholin-4-yl)-5-fluoroaniline |
| SMILES | CC1CN(c2cc(Cl)c(F)cc2N)CC(C)O1 |
| InChI | InChI=1S/C12H16ClFN2O/c1-7-5-16(6-8(2)17-7)12-3-9(13)10(14)4-11(12)15/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | IMJUIWDLVCEGQR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|