C13H17F3N2O2 — CID 104957827
4-(difluoromethoxy)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-fluoroaniline (PubChem CID 104957827) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-fluoroaniline.
| Compound Name | 4-(difluoromethoxy)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-fluoroaniline |
|---|---|
| PubChem CID | 104957827 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-(difluoromethoxy)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-fluoroaniline |
| SMILES | C[C@@H]1CN(c2cc(OC(F)F)c(F)cc2N)C[C@H](C)O1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-7-5-18(6-8(2)19-7)11-4-12(20-13(15)16)9(14)3-10(11)17/h3-4,7-8,13H,5-6,17H2,1-2H3/t7-,8+ |
| InChIKey | XEKTWPBPBAQMFA-OCAPTIKFSA-N |
| XLogP | 2.62 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|