C12H19Cl2N3O — CID 21087634
N-[1-(4-aminophenyl)pyrrolidin-3-yl]acetamide;dihydrochloride (PubChem CID 21087634) has the molecular formula C12H19Cl2N3O and a molecular weight of 292.21 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)pyrrolidin-3-yl]acetamide;dihydrochloride.
| Compound Name | N-[1-(4-aminophenyl)pyrrolidin-3-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 21087634 |
| Molecular Formula | C12H19Cl2N3O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[1-(4-aminophenyl)pyrrolidin-3-yl]acetamide;dihydrochloride |
| SMILES | CC(=O)NC1CCN(c2ccc(N)cc2)C1.Cl.Cl |
| InChI | InChI=1S/C12H17N3O.2ClH/c1-9(16)14-11-6-7-15(8-11)12-4-2-10(13)3-5-12;;/h2-5,11H,6-8,13H2,1H3,(H,14,16);2*1H |
| InChIKey | XXSQQOLWGHJGGY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|