C25H26N4O2 — CID 174677274
4-[(3S)-3-acetamidopyrrolidin-1-yl]-N-(5-amino-2-phenylphenyl)benzamide (PubChem CID 174677274) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[(3S)-3-acetamidopyrrolidin-1-yl]-N-(5-amino-2-phenylphenyl)benzamide.
| Compound Name | 4-[(3S)-3-acetamidopyrrolidin-1-yl]-N-(5-amino-2-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 174677274 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[(3S)-3-acetamidopyrrolidin-1-yl]-N-(5-amino-2-phenylphenyl)benzamide |
| SMILES | CC(=O)N[C@H]1CCN(c2ccc(C(=O)Nc3cc(N)ccc3-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H26N4O2/c1-17(30)27-21-13-14-29(16-21)22-10-7-19(8-11-22)25(31)28-24-15-20(26)9-12-23(24)18-5-3-2-4-6-18/h2-12,15,21H,13-14,16,26H2,1H3,(H,27,30)(H,28,31)/t21-/m0/s1 |
| InChIKey | SEROSNDUNUJCEG-NRFANRHFSA-N |
| XLogP | 3.90 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|