C22H27N5O3 — CID 25071026
N-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]morpholine-4-carboxamide (PubChem CID 25071026) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 25071026 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]morpholine-4-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CC[C@H](NC(=O)N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C22H27N5O3/c23-19-3-1-2-4-20(19)25-21(28)16-5-7-18(8-6-16)27-10-9-17(15-27)24-22(29)26-11-13-30-14-12-26/h1-8,17H,9-15,23H2,(H,24,29)(H,25,28)/t17-/m0/s1 |
| InChIKey | LBFHWFNYZXAOMS-KRWDZBQOSA-N |
| XLogP | 2.14 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|