C23H28N4O4 — CID 118643888
[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(oxan-4-yl)carbamic acid (PubChem CID 118643888) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(oxan-4-yl)carbamic acid.
| Compound Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(oxan-4-yl)carbamic acid |
|---|---|
| PubChem CID | 118643888 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(oxan-4-yl)carbamic acid |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CC[C@H](N(C(=O)O)C3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c24-20-3-1-2-4-21(20)25-22(28)16-5-7-17(8-6-16)26-12-9-19(15-26)27(23(29)30)18-10-13-31-14-11-18/h1-8,18-19H,9-15,24H2,(H,25,28)(H,29,30)/t19-/m0/s1 |
| InChIKey | CNWMBPFXMQZNRS-IBGZPJMESA-N |
| XLogP | 3.26 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|