C22H26N4O3 — CID 69299626
[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(cyclopropylmethyl)carbamic acid (PubChem CID 69299626) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(cyclopropylmethyl)carbamic acid.
| Compound Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(cyclopropylmethyl)carbamic acid |
|---|---|
| PubChem CID | 69299626 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl]-(cyclopropylmethyl)carbamic acid |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CC[C@H](N(CC3CC3)C(=O)O)C2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c23-19-3-1-2-4-20(19)24-21(27)16-7-9-17(10-8-16)25-12-11-18(14-25)26(22(28)29)13-15-5-6-15/h1-4,7-10,15,18H,5-6,11-14,23H2,(H,24,27)(H,28,29)/t18-/m0/s1 |
| InChIKey | AAHHUFYAFPWXFA-SFHVURJKSA-N |
| XLogP | 3.49 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|