C26H26F3N3O — CID 159822265
N-(2-amino-5-phenylphenyl)-4-[(3S)-3-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]benzamide (PubChem CID 159822265) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[(3S)-3-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[(3S)-3-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 159822265 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[(3S)-3-(3,3,3-trifluoropropyl)pyrrolidin-1-yl]benzamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc(N2CC[C@H](CCC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C26H26F3N3O/c27-26(28,29)14-12-18-13-15-32(17-18)22-9-6-20(7-10-22)25(33)31-24-16-21(8-11-23(24)30)19-4-2-1-3-5-19/h1-11,16,18H,12-15,17,30H2,(H,31,33)/t18-/m0/s1 |
| InChIKey | CKFLOALMVLVYOZ-SFHVURJKSA-N |
| XLogP | 6.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|