C20H21F2N3O3 — CID 16748954
benzyl N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 16748954) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is benzyl N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 16748954 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | benzyl N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(F)cc2F)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C20H21F2N3O3/c21-16-6-7-18(17(22)12-16)24-8-10-25(11-9-24)19(26)13-23-20(27)28-14-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,23,27) |
| InChIKey | TWIBPNOIQLHYGM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |