C24H24FN3O2 — CID 67225663
benzyl N-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]carbamate (PubChem CID 67225663) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is benzyl N-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]carbamate.
| Compound Name | benzyl N-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 67225663 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | benzyl N-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccc3)CC2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C24H24FN3O2/c25-22-17-20(26-24(29)30-18-19-7-3-1-4-8-19)11-12-23(22)28-15-13-27(14-16-28)21-9-5-2-6-10-21/h1-12,17H,13-16,18H2,(H,26,29) |
| InChIKey | GHXYHOFSDVPDMZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|