C19H17FN2O2S — CID 159351447
benzyl N-[3-fluoro-4-(7H-1,4-thiazepin-4-yl)phenyl]carbamate (PubChem CID 159351447) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is benzyl N-[3-fluoro-4-(7H-1,4-thiazepin-4-yl)phenyl]carbamate.
| Compound Name | benzyl N-[3-fluoro-4-(7H-1,4-thiazepin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 159351447 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | benzyl N-[3-fluoro-4-(7H-1,4-thiazepin-4-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2C=CCSC=C2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H17FN2O2S/c20-17-13-16(7-8-18(17)22-9-4-11-25-12-10-22)21-19(23)24-14-15-5-2-1-3-6-15/h1-10,12-13H,11,14H2,(H,21,23) |
| InChIKey | LHJMKRIPVNGDML-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |