C17H18N2O3 — CID 110639583
benzyl N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)carbamate (PubChem CID 110639583) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is benzyl N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)carbamate.
| Compound Name | benzyl N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)carbamate |
|---|---|
| PubChem CID | 110639583 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | benzyl N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)carbamate |
| SMILES | CN1CCOc2ccc(NC(=O)OCc3ccccc3)cc21 |
| InChI | InChI=1S/C17H18N2O3/c1-19-9-10-21-16-8-7-14(11-15(16)19)18-17(20)22-12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3,(H,18,20) |
| InChIKey | OVFWEAUFFMLABX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |