C16H15ClN2O2 — CID 110639571
2-chloro-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide (PubChem CID 110639571) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-chloro-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 2-chloro-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 110639571 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-chloro-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide |
| SMILES | CN1CCOc2ccc(NC(=O)c3ccccc3Cl)cc21 |
| InChI | InChI=1S/C16H15ClN2O2/c1-19-8-9-21-15-7-6-11(10-14(15)19)18-16(20)12-4-2-3-5-13(12)17/h2-7,10H,8-9H2,1H3,(H,18,20) |
| InChIKey | CDNQJOGOXTXQJO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |