C14H14N2O3 — CID 110639535
N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)furan-2-carboxamide (PubChem CID 110639535) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)furan-2-carboxamide.
| Compound Name | N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110639535 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)furan-2-carboxamide |
| SMILES | CN1CCOc2ccc(NC(=O)c3ccco3)cc21 |
| InChI | InChI=1S/C14H14N2O3/c1-16-6-8-19-12-5-4-10(9-11(12)16)15-14(17)13-3-2-7-18-13/h2-5,7,9H,6,8H2,1H3,(H,15,17) |
| InChIKey | SRGDWYQQUSMKJS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |