C16H14Br2N2O2 — CID 167856806
2,6-dibromo-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide (PubChem CID 167856806) has the molecular formula C16H14Br2N2O2 and a molecular weight of 426.11 g/mol. Its IUPAC name is 2,6-dibromo-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 2,6-dibromo-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 167856806 |
| Molecular Formula | C16H14Br2N2O2 |
| Molecular Weight | 426.11 g/mol |
| Exact Mass | 423.94 |
| IUPAC Name | 2,6-dibromo-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)benzamide |
| SMILES | CN1CCOc2ccc(NC(=O)c3c(Br)cccc3Br)cc21 |
| InChI | InChI=1S/C16H14Br2N2O2/c1-20-7-8-22-14-6-5-10(9-13(14)20)19-16(21)15-11(17)3-2-4-12(15)18/h2-6,9H,7-8H2,1H3,(H,19,21) |
| InChIKey | DYWBYADXJBRMNM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |