C14H14N2O2 — CID 110729319
N-(1-methyl-2,3-dihydroindol-5-yl)furan-2-carboxamide (PubChem CID 110729319) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(1-methyl-2,3-dihydroindol-5-yl)furan-2-carboxamide.
| Compound Name | N-(1-methyl-2,3-dihydroindol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110729319 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(1-methyl-2,3-dihydroindol-5-yl)furan-2-carboxamide |
| SMILES | CN1CCc2cc(NC(=O)c3ccco3)ccc21 |
| InChI | InChI=1S/C14H14N2O2/c1-16-7-6-10-9-11(4-5-12(10)16)15-14(17)13-3-2-8-18-13/h2-5,8-9H,6-7H2,1H3,(H,15,17) |
| InChIKey | YLMANYYYBDCMAD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|